C19H12O5 — CID 154674970
5-hydroxy-2-[hydroxy(phenyl)methyl]benzo[f][1]benzofuran-4,9-dione (PubChem CID 154674970) has the molecular formula C19H12O5 and a molecular weight of 320.30 g/mol. Its IUPAC name is 5-hydroxy-2-[hydroxy(phenyl)methyl]benzo[f][1]benzofuran-4,9-dione.
| Compound Name | 5-hydroxy-2-[hydroxy(phenyl)methyl]benzo[f][1]benzofuran-4,9-dione |
|---|---|
| PubChem CID | 154674970 |
| Molecular Formula | C19H12O5 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 5-hydroxy-2-[hydroxy(phenyl)methyl]benzo[f][1]benzofuran-4,9-dione |
| SMILES | O=C1c2cccc(O)c2C(=O)c2cc(C(O)c3ccccc3)oc21 |
| InChI | InChI=1S/C19H12O5/c20-13-8-4-7-11-15(13)17(22)12-9-14(24-19(12)18(11)23)16(21)10-5-2-1-3-6-10/h1-9,16,20-21H |
| InChIKey | OJASXPYQWMQOPN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|