C14H9FO4 — CID 154674974
2-(1-fluoroethyl)-6-hydroxybenzo[g][1]benzofuran-4,5-dione (PubChem CID 154674974) has the molecular formula C14H9FO4 and a molecular weight of 260.22 g/mol. Its IUPAC name is 2-(1-fluoroethyl)-6-hydroxybenzo[g][1]benzofuran-4,5-dione.
| Compound Name | 2-(1-fluoroethyl)-6-hydroxybenzo[g][1]benzofuran-4,5-dione |
|---|---|
| PubChem CID | 154674974 |
| Molecular Formula | C14H9FO4 |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 2-(1-fluoroethyl)-6-hydroxybenzo[g][1]benzofuran-4,5-dione |
| SMILES | CC(F)c1cc2c(o1)-c1cccc(O)c1C(=O)C2=O |
| InChI | InChI=1S/C14H9FO4/c1-6(15)10-5-8-12(17)13(18)11-7(14(8)19-10)3-2-4-9(11)16/h2-6,16H,1H3 |
| InChIKey | WLXWYRPJAQELLI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|