C15H13NO4 — CID 118211434
2-tert-butyl-9-hydroxybenzo[g][1,3]benzoxazole-4,5-dione (PubChem CID 118211434) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is 2-tert-butyl-9-hydroxybenzo[g][1,3]benzoxazole-4,5-dione.
| Compound Name | 2-tert-butyl-9-hydroxybenzo[g][1,3]benzoxazole-4,5-dione |
|---|---|
| PubChem CID | 118211434 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-tert-butyl-9-hydroxybenzo[g][1,3]benzoxazole-4,5-dione |
| SMILES | CC(C)(C)c1nc2c(o1)-c1c(O)cccc1C(=O)C2=O |
| InChI | InChI=1S/C15H13NO4/c1-15(2,3)14-16-10-12(19)11(18)7-5-4-6-8(17)9(7)13(10)20-14/h4-6,17H,1-3H3 |
| InChIKey | QCPDUXFCXKVXQK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|