C13H9NO2 — CID 135753482
9-hydroxy-4-methylindeno[1,2-b]pyridin-5-one (PubChem CID 135753482) has the molecular formula C13H9NO2 and a molecular weight of 211.22 g/mol. Its IUPAC name is 9-hydroxy-4-methylindeno[1,2-b]pyridin-5-one.
| Compound Name | 9-hydroxy-4-methylindeno[1,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 135753482 |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 9-hydroxy-4-methylindeno[1,2-b]pyridin-5-one |
| SMILES | Cc1ccnc2c1C(=O)c1cccc(O)c1-2 |
| InChI | InChI=1S/C13H9NO2/c1-7-5-6-14-12-10(7)13(16)8-3-2-4-9(15)11(8)12/h2-6,15H,1H3 |
| InChIKey | OPRGROBOSIETIL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|