C16H12O6 — CID 177435085
2-acetyl-6-(methoxymethoxy)benzo[g][1]benzofuran-4,5-dione (PubChem CID 177435085) has the molecular formula C16H12O6 and a molecular weight of 300.27 g/mol. Its IUPAC name is 2-acetyl-6-(methoxymethoxy)benzo[g][1]benzofuran-4,5-dione.
| Compound Name | 2-acetyl-6-(methoxymethoxy)benzo[g][1]benzofuran-4,5-dione |
|---|---|
| PubChem CID | 177435085 |
| Molecular Formula | C16H12O6 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-acetyl-6-(methoxymethoxy)benzo[g][1]benzofuran-4,5-dione |
| SMILES | COCOc1cccc2c1C(=O)C(=O)c1cc(C(C)=O)oc1-2 |
| InChI | InChI=1S/C16H12O6/c1-8(17)12-6-10-14(18)15(19)13-9(16(10)22-12)4-3-5-11(13)21-7-20-2/h3-6H,7H2,1-2H3 |
| InChIKey | VEQFCCKLCIBKRM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|