C18H20O6 — CID 135012085
3,6-dimethoxy-2-[2-methoxy-6-(methoxymethoxy)phenyl]benzaldehyde (PubChem CID 135012085) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is 3,6-dimethoxy-2-[2-methoxy-6-(methoxymethoxy)phenyl]benzaldehyde.
| Compound Name | 3,6-dimethoxy-2-[2-methoxy-6-(methoxymethoxy)phenyl]benzaldehyde |
|---|---|
| PubChem CID | 135012085 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 3,6-dimethoxy-2-[2-methoxy-6-(methoxymethoxy)phenyl]benzaldehyde |
| SMILES | COCOc1cccc(OC)c1-c1c(OC)ccc(OC)c1C=O |
| InChI | InChI=1S/C18H20O6/c1-20-11-24-16-7-5-6-14(22-3)18(16)17-12(10-19)13(21-2)8-9-15(17)23-4/h5-10H,11H2,1-4H3 |
| InChIKey | CXWZHKLNYJTNCI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|