C19H22O7 — CID 135029975
2-[2,6-bis(methoxymethoxy)phenyl]-3,6-dimethoxybenzaldehyde (PubChem CID 135029975) has the molecular formula C19H22O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is 2-[2,6-bis(methoxymethoxy)phenyl]-3,6-dimethoxybenzaldehyde.
| Compound Name | 2-[2,6-bis(methoxymethoxy)phenyl]-3,6-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 135029975 |
| Molecular Formula | C19H22O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-[2,6-bis(methoxymethoxy)phenyl]-3,6-dimethoxybenzaldehyde |
| SMILES | COCOc1cccc(OCOC)c1-c1c(OC)ccc(OC)c1C=O |
| InChI | InChI=1S/C19H22O7/c1-21-11-25-16-6-5-7-17(26-12-22-2)19(16)18-13(10-20)14(23-3)8-9-15(18)24-4/h5-10H,11-12H2,1-4H3 |
| InChIKey | WJZNHCNAUGKYLB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|