C24H24O7 — CID 135029831
2-[2,6-bis(methoxymethoxy)phenyl]-3-hydroxy-6-phenylmethoxybenzaldehyde (PubChem CID 135029831) has the molecular formula C24H24O7 and a molecular weight of 424.45 g/mol. Its IUPAC name is 2-[2,6-bis(methoxymethoxy)phenyl]-3-hydroxy-6-phenylmethoxybenzaldehyde.
| Compound Name | 2-[2,6-bis(methoxymethoxy)phenyl]-3-hydroxy-6-phenylmethoxybenzaldehyde |
|---|---|
| PubChem CID | 135029831 |
| Molecular Formula | C24H24O7 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-[2,6-bis(methoxymethoxy)phenyl]-3-hydroxy-6-phenylmethoxybenzaldehyde |
| SMILES | COCOc1cccc(OCOC)c1-c1c(O)ccc(OCc2ccccc2)c1C=O |
| InChI | InChI=1S/C24H24O7/c1-27-15-30-21-9-6-10-22(31-16-28-2)24(21)23-18(13-25)20(12-11-19(23)26)29-14-17-7-4-3-5-8-17/h3-13,26H,14-16H2,1-2H3 |
| InChIKey | RGEIRQUHKBHITC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|