C30H28O5 — CID 142703348
2-(2-hydroxy-6-phenylmethoxyphenyl)-3-(4-phenylmethoxybut-1-enyl)benzene-1,4-diol (PubChem CID 142703348) has the molecular formula C30H28O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is 2-(2-hydroxy-6-phenylmethoxyphenyl)-3-(4-phenylmethoxybut-1-enyl)benzene-1,4-diol.
| Compound Name | 2-(2-hydroxy-6-phenylmethoxyphenyl)-3-(4-phenylmethoxybut-1-enyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 142703348 |
| Molecular Formula | C30H28O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 2-(2-hydroxy-6-phenylmethoxyphenyl)-3-(4-phenylmethoxybut-1-enyl)benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(-c2c(O)cccc2OCc2ccccc2)c1C=CCCOCc1ccccc1 |
| InChI | InChI=1S/C30H28O5/c31-25-17-18-27(33)29(24(25)14-7-8-19-34-20-22-10-3-1-4-11-22)30-26(32)15-9-16-28(30)35-21-23-12-5-2-6-13-23/h1-7,9-18,31-33H,8,19-21H2 |
| InChIKey | NLBITPLBAZUKAJ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|