About 5-bromo-2-hydroxybenzaldehyde;4-bromo-2-[(E)-4-phenylmethoxybut-1-enyl]phenol
5-bromo-2-hydroxybenzaldehyde;4-bromo-2-[(E)-4-phenylmethoxybut-1-enyl]phenol (PubChem CID 159341979) has the molecular formula C24H22Br2O4
and a molecular weight of 534.24 g/mol. Its IUPAC name is 5-bromo-2-hydroxybenzaldehyde;4-bromo-2-[(E)-4-phenylmethoxybut-1-enyl]phenol.
Molecular Properties
| Compound Name | 5-bromo-2-hydroxybenzaldehyde;4-bromo-2-[(E)-4-phenylmethoxybut-1-enyl]phenol |
| PubChem CID | 159341979 |
| Molecular Formula | C24H22Br2O4 |
| Molecular Weight | 534.24 g/mol |
| Exact Mass | 531.99 |
| IUPAC Name | 5-bromo-2-hydroxybenzaldehyde;4-bromo-2-[(E)-4-phenylmethoxybut-1-enyl]phenol |
| SMILES | O=Cc1cc(Br)ccc1O.Oc1ccc(Br)cc1/C=C/CCOCc1ccccc1 |
| InChI | InChI=1S/C17H17BrO2.C7H5BrO2/c18-16-9-10-17(19)15(12-16)8-4-5-11-20-13-14-6-2-1-3-7-14;8-6-1-2-7(10)5(3-6)4-9/h1-4,6-10,12,19H,5,11,13H2;1-4,10H/b8-4+; |
| InChIKey | LGGDQOXLSFZOND-ZFXMFRGYSA-N |
| XLogP | 6.74 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 534.24 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-hydroxybenzaldehyde;4-bromo-2-[(E)-4-phenylmethoxybut-1-enyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-hydroxybenzaldehyde;4-bromo-2-[(E)-4-phenylmethoxybut-1-enyl]phenol?
The IUPAC name of 5-bromo-2-hydroxybenzaldehyde;4-bromo-2-[(E)-4-phenylmethoxybut-1-enyl]phenol (CID 159341979) is 5-bromo-2-hydroxybenzaldehyde;4-bromo-2-[(E)-4-phenylmethoxybut-1-enyl]phenol.
What is the SMILES notation for 5-bromo-2-hydroxybenzaldehyde;4-bromo-2-[(E)-4-phenylmethoxybut-1-enyl]phenol?
The canonical SMILES for 5-bromo-2-hydroxybenzaldehyde;4-bromo-2-[(E)-4-phenylmethoxybut-1-enyl]phenol is O=Cc1cc(Br)ccc1O.Oc1ccc(Br)cc1/C=C/CCOCc1ccccc1.
What is the InChIKey of 5-bromo-2-hydroxybenzaldehyde;4-bromo-2-[(E)-4-phenylmethoxybut-1-enyl]phenol?
The InChIKey is LGGDQOXLSFZOND-ZFXMFRGYSA-N. The full InChI is InChI=1S/C17H17BrO2.C7H5BrO2/c18-16-9-10-17(19)15(12-16)8-4-5-11-20-13-14-6-2-1-3-7-14;8-6-1-2-7(10)5(3-6)4-9/h1-4,6-10,12,19H,5,11,13H2;1-4,10H/b8-4+;.
What are the key properties of 5-bromo-2-hydroxybenzaldehyde;4-bromo-2-[(E)-4-phenylmethoxybut-1-enyl]phenol?
5-bromo-2-hydroxybenzaldehyde;4-bromo-2-[(E)-4-phenylmethoxybut-1-enyl]phenol has a molecular weight of 534.24 g/mol, XLogP of 6.74, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-hydroxybenzaldehyde;4-bromo-2-[(E)-4-phenylmethoxybut-1-enyl]phenol is sourced from PubChem (CID 159341979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).