C21H20O7 — CID 11047238
3-(1,3-dioxan-2-yl)-8-methoxy-1-(methoxymethoxy)anthracene-9,10-dione (PubChem CID 11047238) has the molecular formula C21H20O7 and a molecular weight of 384.38 g/mol. Its IUPAC name is 3-(1,3-dioxan-2-yl)-8-methoxy-1-(methoxymethoxy)anthracene-9,10-dione.
| Compound Name | 3-(1,3-dioxan-2-yl)-8-methoxy-1-(methoxymethoxy)anthracene-9,10-dione |
|---|---|
| PubChem CID | 11047238 |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 3-(1,3-dioxan-2-yl)-8-methoxy-1-(methoxymethoxy)anthracene-9,10-dione |
| SMILES | COCOc1cc(C2OCCCO2)cc2c1C(=O)c1c(OC)cccc1C2=O |
| InChI | InChI=1S/C21H20O7/c1-24-11-28-16-10-12(21-26-7-4-8-27-21)9-14-18(16)20(23)17-13(19(14)22)5-3-6-15(17)25-2/h3,5-6,9-10,21H,4,7-8,11H2,1-2H3 |
| InChIKey | GBECMTIXHJCVDD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|