C25H26O9 — CID 10791289
3-[2-(1,3-dioxan-2-yl)-6-(methoxymethoxy)-4-methylphenyl]-4-hydroxy-8-(methoxymethoxy)naphthalene-1,2-dione (PubChem CID 10791289) has the molecular formula C25H26O9 and a molecular weight of 470.47 g/mol. Its IUPAC name is 3-[2-(1,3-dioxan-2-yl)-6-(methoxymethoxy)-4-methylphenyl]-4-hydroxy-8-(methoxymethoxy)naphthalene-1,2-dione.
| Compound Name | 3-[2-(1,3-dioxan-2-yl)-6-(methoxymethoxy)-4-methylphenyl]-4-hydroxy-8-(methoxymethoxy)naphthalene-1,2-dione |
|---|---|
| PubChem CID | 10791289 |
| Molecular Formula | C25H26O9 |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 3-[2-(1,3-dioxan-2-yl)-6-(methoxymethoxy)-4-methylphenyl]-4-hydroxy-8-(methoxymethoxy)naphthalene-1,2-dione |
| SMILES | COCOc1cccc2c1C(=O)C(=O)C(c1c(OCOC)cc(C)cc1C1OCCCO1)=C2O |
| InChI | InChI=1S/C25H26O9/c1-14-10-16(25-31-8-5-9-32-25)19(18(11-14)34-13-30-3)21-22(26)15-6-4-7-17(33-12-29-2)20(15)23(27)24(21)28/h4,6-7,10-11,25-26H,5,8-9,12-13H2,1-3H3 |
| InChIKey | PKTZSDHFZAZZLP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|