C20H15N2O4+ — CID 10783760
5-hydroxy-4,9-dimethoxy-2-methyl-10-oxobenzo[b]fluorene-11-diazonium (PubChem CID 10783760) has the molecular formula C20H15N2O4+ and a molecular weight of 347.35 g/mol. Its IUPAC name is 5-hydroxy-4,9-dimethoxy-2-methyl-10-oxobenzo[b]fluorene-11-diazonium.
| Compound Name | 5-hydroxy-4,9-dimethoxy-2-methyl-10-oxobenzo[b]fluorene-11-diazonium |
|---|---|
| PubChem CID | 10783760 |
| Molecular Formula | C20H15N2O4+ |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 5-hydroxy-4,9-dimethoxy-2-methyl-10-oxobenzo[b]fluorene-11-diazonium |
| SMILES | COc1cccc2c1C(=O)C1=C([N+]#N)c3cc(C)cc(OC)c3C1=C2O |
| InChI | InChI=1S/C20H14N2O4/c1-9-7-11-14(13(8-9)26-3)16-17(18(11)22-21)20(24)15-10(19(16)23)5-4-6-12(15)25-2/h4-8H,1-3H3/p+1 |
| InChIKey | IVUAJUULCCNHHL-UHFFFAOYSA-O |
| XLogP | 4.21 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|