C14H9NO5 — CID 142308043
2-acetyl-7-methoxyfuro[2,3-g]quinoline-4,9-dione (PubChem CID 142308043) has the molecular formula C14H9NO5 and a molecular weight of 271.23 g/mol. Its IUPAC name is 2-acetyl-7-methoxyfuro[2,3-g]quinoline-4,9-dione.
| Compound Name | 2-acetyl-7-methoxyfuro[2,3-g]quinoline-4,9-dione |
|---|---|
| PubChem CID | 142308043 |
| Molecular Formula | C14H9NO5 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 2-acetyl-7-methoxyfuro[2,3-g]quinoline-4,9-dione |
| SMILES | COc1cnc2c(c1)C(=O)c1oc(C(C)=O)cc1C2=O |
| InChI | InChI=1S/C14H9NO5/c1-6(16)10-4-9-12(17)11-8(13(18)14(9)20-10)3-7(19-2)5-15-11/h3-5H,1-2H3 |
| InChIKey | HZKCMZYFTVDVRZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 86.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|