C14H7ClO5 — CID 134544093
2-acetyl-7-chloro-5-hydroxybenzo[f][1]benzofuran-4,9-dione (PubChem CID 134544093) has the molecular formula C14H7ClO5 and a molecular weight of 290.66 g/mol. Its IUPAC name is 2-acetyl-7-chloro-5-hydroxybenzo[f][1]benzofuran-4,9-dione.
| Compound Name | 2-acetyl-7-chloro-5-hydroxybenzo[f][1]benzofuran-4,9-dione |
|---|---|
| PubChem CID | 134544093 |
| Molecular Formula | C14H7ClO5 |
| Molecular Weight | 290.66 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | 2-acetyl-7-chloro-5-hydroxybenzo[f][1]benzofuran-4,9-dione |
| SMILES | CC(=O)c1cc2c(o1)C(=O)c1cc(Cl)cc(O)c1C2=O |
| InChI | InChI=1S/C14H7ClO5/c1-5(16)10-4-8-12(18)11-7(13(19)14(8)20-10)2-6(15)3-9(11)17/h2-4,17H,1H3 |
| InChIKey | KMYUDMRSISNLLK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.66 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|