C17H10O5 — CID 162982307
10-hydroxy-7-prop-1-en-2-yl-[1]benzofuro[5,6-f][1]benzofuran-5,9-dione (PubChem CID 162982307) has the molecular formula C17H10O5 and a molecular weight of 294.26 g/mol. Its IUPAC name is 10-hydroxy-7-prop-1-en-2-yl-[1]benzofuro[5,6-f][1]benzofuran-5,9-dione.
| Compound Name | 10-hydroxy-7-prop-1-en-2-yl-[1]benzofuro[5,6-f][1]benzofuran-5,9-dione |
|---|---|
| PubChem CID | 162982307 |
| Molecular Formula | C17H10O5 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 10-hydroxy-7-prop-1-en-2-yl-[1]benzofuro[5,6-f][1]benzofuran-5,9-dione |
| SMILES | C=C(C)c1cc2c(o1)C(=O)c1c(cc3ccoc3c1O)C2=O |
| InChI | InChI=1S/C17H10O5/c1-7(2)11-6-10-13(18)9-5-8-3-4-21-16(8)14(19)12(9)15(20)17(10)22-11/h3-6,19H,1H2,2H3 |
| InChIKey | UIPQLRGGCGCEKR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|