C21H12O4 — CID 71439122
11,12-dihydroxy-15-phenyl-14-oxatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one (PubChem CID 71439122) has the molecular formula C21H12O4 and a molecular weight of 328.32 g/mol. Its IUPAC name is 11,12-dihydroxy-15-phenyl-14-oxatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one.
| Compound Name | 11,12-dihydroxy-15-phenyl-14-oxatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one |
|---|---|
| PubChem CID | 71439122 |
| Molecular Formula | C21H12O4 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 11,12-dihydroxy-15-phenyl-14-oxatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one |
| SMILES | O=C1c2ccccc2-c2c(-c3ccccc3)oc3c(O)c(O)cc1c23 |
| InChI | InChI=1S/C21H12O4/c22-15-10-14-17-16(12-8-4-5-9-13(12)18(14)23)20(25-21(17)19(15)24)11-6-2-1-3-7-11/h1-10,22,24H |
| InChIKey | CMSNZRZHKNVZJG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|