C15H8O6 — CID 68853397
2,3-dihydroxy-9,10-dioxoanthracene-1-carboxylic acid (PubChem CID 68853397) has the molecular formula C15H8O6 and a molecular weight of 284.22 g/mol. Its IUPAC name is 2,3-dihydroxy-9,10-dioxoanthracene-1-carboxylic acid.
| Compound Name | 2,3-dihydroxy-9,10-dioxoanthracene-1-carboxylic acid |
|---|---|
| PubChem CID | 68853397 |
| Molecular Formula | C15H8O6 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 2,3-dihydroxy-9,10-dioxoanthracene-1-carboxylic acid |
| SMILES | O=C1c2ccccc2C(=O)c2c1cc(O)c(O)c2C(=O)O |
| InChI | InChI=1S/C15H8O6/c16-9-5-8-10(11(14(9)19)15(20)21)13(18)7-4-2-1-3-6(7)12(8)17/h1-5,16,19H,(H,20,21) |
| InChIKey | NMUCSHYWYUENRY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|