C18H10O5 — CID 162929112
7,8-dihydroxy-10-phenyl-3-oxatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaene-2,4-dione (PubChem CID 162929112) has the molecular formula C18H10O5 and a molecular weight of 306.27 g/mol. Its IUPAC name is 7,8-dihydroxy-10-phenyl-3-oxatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaene-2,4-dione.
| Compound Name | 7,8-dihydroxy-10-phenyl-3-oxatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaene-2,4-dione |
|---|---|
| PubChem CID | 162929112 |
| Molecular Formula | C18H10O5 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 7,8-dihydroxy-10-phenyl-3-oxatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaene-2,4-dione |
| SMILES | O=C1OC(=O)c2cc(O)c(O)c3c(-c4ccccc4)ccc1c23 |
| InChI | InChI=1S/C18H10O5/c19-13-8-12-14-11(17(21)23-18(12)22)7-6-10(15(14)16(13)20)9-4-2-1-3-5-9/h1-8,19-20H |
| InChIKey | ODZFJYLPTNQEQL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|