C23H12O5 — CID 143653406
5-(1,3-dioxoinden-5-yl)-6-phenyl-2-benzofuran-1,3-dione (PubChem CID 143653406) has the molecular formula C23H12O5 and a molecular weight of 368.34 g/mol. Its IUPAC name is 5-(1,3-dioxoinden-5-yl)-6-phenyl-2-benzofuran-1,3-dione.
| Compound Name | 5-(1,3-dioxoinden-5-yl)-6-phenyl-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 143653406 |
| Molecular Formula | C23H12O5 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 5-(1,3-dioxoinden-5-yl)-6-phenyl-2-benzofuran-1,3-dione |
| SMILES | O=C1CC(=O)c2cc(-c3cc4c(cc3-c3ccccc3)C(=O)OC4=O)ccc21 |
| InChI | InChI=1S/C23H12O5/c24-20-11-21(25)17-8-13(6-7-14(17)20)16-10-19-18(22(26)28-23(19)27)9-15(16)12-4-2-1-3-5-12/h1-10H,11H2 |
| InChIKey | ZUKKQCDIHHLMBN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|