C35H20O5 — CID 143653383
4,8-bis(4-phenylphenyl)cyclopenta[f][2]benzofuran-1,3,5,7-tetrone (PubChem CID 143653383) has the molecular formula C35H20O5 and a molecular weight of 520.54 g/mol. Its IUPAC name is 4,8-bis(4-phenylphenyl)cyclopenta[f][2]benzofuran-1,3,5,7-tetrone.
| Compound Name | 4,8-bis(4-phenylphenyl)cyclopenta[f][2]benzofuran-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 143653383 |
| Molecular Formula | C35H20O5 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | 4,8-bis(4-phenylphenyl)cyclopenta[f][2]benzofuran-1,3,5,7-tetrone |
| SMILES | O=C1CC(=O)c2c1c(-c1ccc(-c3ccccc3)cc1)c1c(c2-c2ccc(-c3ccccc3)cc2)C(=O)OC1=O |
| InChI | InChI=1S/C35H20O5/c36-26-19-27(37)31-29(25-17-13-23(14-18-25)21-9-5-2-6-10-21)33-32(34(38)40-35(33)39)28(30(26)31)24-15-11-22(12-16-24)20-7-3-1-4-8-20/h1-18H,19H2 |
| InChIKey | WMGLKFMWJFNTQE-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|