C17H8O5 — CID 143653389
6-methylidene-4-phenylfuro[3,4-e][2]benzofuran-1,3,8-trione (PubChem CID 143653389) has the molecular formula C17H8O5 and a molecular weight of 292.25 g/mol. Its IUPAC name is 6-methylidene-4-phenylfuro[3,4-e][2]benzofuran-1,3,8-trione.
| Compound Name | 6-methylidene-4-phenylfuro[3,4-e][2]benzofuran-1,3,8-trione |
|---|---|
| PubChem CID | 143653389 |
| Molecular Formula | C17H8O5 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 6-methylidene-4-phenylfuro[3,4-e][2]benzofuran-1,3,8-trione |
| SMILES | C=C1OC(=O)c2c1cc(-c1ccccc1)c1c2C(=O)OC1=O |
| InChI | InChI=1S/C17H8O5/c1-8-10-7-11(9-5-3-2-4-6-9)13-14(12(10)15(18)21-8)17(20)22-16(13)19/h2-7H,1H2 |
| InChIKey | CIQQYCLFMQXMOF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|