C26H16O5 — CID 123358491
23-methylidene-7,24-dioxahexacyclo[18.7.0.03,11.05,9.013,18.022,26]heptacosa-1(27),3,5(9),10,13,15,17,20,22(26)-nonaene-6,8,25-trione (PubChem CID 123358491) has the molecular formula C26H16O5 and a molecular weight of 408.41 g/mol. Its IUPAC name is 23-methylidene-7,24-dioxahexacyclo[18.7.0.03,11.05,9.013,18.022,26]heptacosa-1(27),3,5(9),10,13,15,17,20,22(26)-nonaene-6,8,25-trione.
| Compound Name | 23-methylidene-7,24-dioxahexacyclo[18.7.0.03,11.05,9.013,18.022,26]heptacosa-1(27),3,5(9),10,13,15,17,20,22(26)-nonaene-6,8,25-trione |
|---|---|
| PubChem CID | 123358491 |
| Molecular Formula | C26H16O5 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 23-methylidene-7,24-dioxahexacyclo[18.7.0.03,11.05,9.013,18.022,26]heptacosa-1(27),3,5(9),10,13,15,17,20,22(26)-nonaene-6,8,25-trione |
| SMILES | C=C1OC(=O)c2cc3c(cc21)Cc1ccccc1Cc1cc2c(cc1C3)C(=O)OC2=O |
| InChI | InChI=1S/C26H16O5/c1-13-20-9-16-6-14-4-2-3-5-15(14)7-17-11-22-23(26(29)31-25(22)28)12-19(17)8-18(16)10-21(20)24(27)30-13/h2-5,9-12H,1,6-8H2 |
| InChIKey | DSJOCNPNJJYSMO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|