C9H4Cl2O2 — CID 118463747
5,6-dichloro-3-methylidene-2-benzofuran-1-one (PubChem CID 118463747) has the molecular formula C9H4Cl2O2 and a molecular weight of 215.03 g/mol. Its IUPAC name is 5,6-dichloro-3-methylidene-2-benzofuran-1-one.
| Compound Name | 5,6-dichloro-3-methylidene-2-benzofuran-1-one |
|---|---|
| PubChem CID | 118463747 |
| Molecular Formula | C9H4Cl2O2 |
| Molecular Weight | 215.03 g/mol |
| Exact Mass | 213.96 |
| IUPAC Name | 5,6-dichloro-3-methylidene-2-benzofuran-1-one |
| SMILES | C=C1OC(=O)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C9H4Cl2O2/c1-4-5-2-7(10)8(11)3-6(5)9(12)13-4/h2-3H,1H2 |
| InChIKey | NQWLVGIWNQCBMV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.03 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |