C18H10O5 — CID 156576329
5-[(3-methylidene-1-oxo-2-benzofuran-5-yl)methyl]-2-benzofuran-1,3-dione (PubChem CID 156576329) has the molecular formula C18H10O5 and a molecular weight of 306.27 g/mol. Its IUPAC name is 5-[(3-methylidene-1-oxo-2-benzofuran-5-yl)methyl]-2-benzofuran-1,3-dione.
| Compound Name | 5-[(3-methylidene-1-oxo-2-benzofuran-5-yl)methyl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 156576329 |
| Molecular Formula | C18H10O5 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 5-[(3-methylidene-1-oxo-2-benzofuran-5-yl)methyl]-2-benzofuran-1,3-dione |
| SMILES | C=C1OC(=O)c2ccc(Cc3ccc4c(c3)C(=O)OC4=O)cc21 |
| InChI | InChI=1S/C18H10O5/c1-9-14-7-10(2-4-12(14)16(19)22-9)6-11-3-5-13-15(8-11)18(21)23-17(13)20/h2-5,7-8H,1,6H2 |
| InChIKey | LLNUULZRPHEFFM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|