C18H10O8S — CID 147272198
5-[(1,3-dioxo-2-benzofuran-5-yl)methoxysulfanyloxymethyl]-2-benzofuran-1,3-dione (PubChem CID 147272198) has the molecular formula C18H10O8S and a molecular weight of 386.34 g/mol. Its IUPAC name is 5-[(1,3-dioxo-2-benzofuran-5-yl)methoxysulfanyloxymethyl]-2-benzofuran-1,3-dione.
| Compound Name | 5-[(1,3-dioxo-2-benzofuran-5-yl)methoxysulfanyloxymethyl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 147272198 |
| Molecular Formula | C18H10O8S |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | 5-[(1,3-dioxo-2-benzofuran-5-yl)methoxysulfanyloxymethyl]-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(COSOCc3ccc4c(c3)C(=O)OC4=O)ccc21 |
| InChI | InChI=1S/C18H10O8S/c19-15-11-3-1-9(5-13(11)17(21)25-15)7-23-27-24-8-10-2-4-12-14(6-10)18(22)26-16(12)20/h1-6H,7-8H2 |
| InChIKey | CQQOCYPWWUVRDG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|