C19H14O8S — CID 142252833
5-[[(Z,4E)-4-[(4E)-4-ethylidene-2,5-dioxooxolan-3-ylidene]but-2-enoxy]sulfanyloxymethyl]-2-benzofuran-1,3-dione (PubChem CID 142252833) has the molecular formula C19H14O8S and a molecular weight of 402.38 g/mol. Its IUPAC name is 5-[[(Z,4E)-4-[(4E)-4-ethylidene-2,5-dioxooxolan-3-ylidene]but-2-enoxy]sulfanyloxymethyl]-2-benzofuran-1,3-dione.
| Compound Name | 5-[[(Z,4E)-4-[(4E)-4-ethylidene-2,5-dioxooxolan-3-ylidene]but-2-enoxy]sulfanyloxymethyl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 142252833 |
| Molecular Formula | C19H14O8S |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | 5-[[(Z,4E)-4-[(4E)-4-ethylidene-2,5-dioxooxolan-3-ylidene]but-2-enoxy]sulfanyloxymethyl]-2-benzofuran-1,3-dione |
| SMILES | C/C=C1/C(=O)OC(=O)/C1=C/C=C\COSOCc1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C19H14O8S/c1-2-12-13(17(21)26-16(12)20)5-3-4-8-24-28-25-10-11-6-7-14-15(9-11)19(23)27-18(14)22/h2-7,9H,8,10H2,1H3/b4-3-,12-2+,13-5+ |
| InChIKey | NJCDNCIUNOFGEB-JWYKVFFZSA-N |
| XLogP | 2.61 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|