C20H14O5 — CID 54291085
5-methyl-6-[(6-methyl-1-methylidene-3-oxo-2-benzofuran-5-yl)methyl]-2-benzofuran-1,3-dione (PubChem CID 54291085) has the molecular formula C20H14O5 and a molecular weight of 334.33 g/mol. Its IUPAC name is 5-methyl-6-[(6-methyl-1-methylidene-3-oxo-2-benzofuran-5-yl)methyl]-2-benzofuran-1,3-dione.
| Compound Name | 5-methyl-6-[(6-methyl-1-methylidene-3-oxo-2-benzofuran-5-yl)methyl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 54291085 |
| Molecular Formula | C20H14O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 5-methyl-6-[(6-methyl-1-methylidene-3-oxo-2-benzofuran-5-yl)methyl]-2-benzofuran-1,3-dione |
| SMILES | C=C1OC(=O)c2cc(Cc3cc4c(cc3C)C(=O)OC4=O)c(C)cc21 |
| InChI | InChI=1S/C20H14O5/c1-9-4-14-11(3)24-18(21)16(14)7-12(9)6-13-8-17-15(5-10(13)2)19(22)25-20(17)23/h4-5,7-8H,3,6H2,1-2H3 |
| InChIKey | RXOGQVIPVRCDLW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|