C25H20O5 — CID 161394033
11,11,22,22-tetramethyl-18-methylidene-6,17-dioxahexacyclo[10.10.0.02,10.04,8.013,21.015,19]docosa-2,4(8),9,13,15(19),20-hexaene-5,7,16-trione (PubChem CID 161394033) has the molecular formula C25H20O5 and a molecular weight of 400.43 g/mol. Its IUPAC name is 11,11,22,22-tetramethyl-18-methylidene-6,17-dioxahexacyclo[10.10.0.02,10.04,8.013,21.015,19]docosa-2,4(8),9,13,15(19),20-hexaene-5,7,16-trione.
| Compound Name | 11,11,22,22-tetramethyl-18-methylidene-6,17-dioxahexacyclo[10.10.0.02,10.04,8.013,21.015,19]docosa-2,4(8),9,13,15(19),20-hexaene-5,7,16-trione |
|---|---|
| PubChem CID | 161394033 |
| Molecular Formula | C25H20O5 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 11,11,22,22-tetramethyl-18-methylidene-6,17-dioxahexacyclo[10.10.0.02,10.04,8.013,21.015,19]docosa-2,4(8),9,13,15(19),20-hexaene-5,7,16-trione |
| SMILES | C=C1OC(=O)c2cc3c(cc21)C(C)(C)C1c2cc4c(cc2C(C)(C)C31)C(=O)OC4=O |
| InChI | InChI=1S/C25H20O5/c1-10-11-8-17-15(6-12(11)21(26)29-10)19-20(24(17,2)3)16-7-13-14(23(28)30-22(13)27)9-18(16)25(19,4)5/h6-9,19-20H,1H2,2-5H3 |
| InChIKey | VTIYDFVZPAZBMQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|