C33H22O6 — CID 163656399
2',7'-dimethylspiro[7,17-dioxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),3,5(9),10,13,15(19)-hexaene-2,9'-fluorene]-6,8,16,18-tetrone;methane (PubChem CID 163656399) has the molecular formula C33H22O6 and a molecular weight of 514.53 g/mol. Its IUPAC name is 2',7'-dimethylspiro[7,17-dioxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),3,5(9),10,13,15(19)-hexaene-2,9'-fluorene]-6,8,16,18-tetrone;methane.
| Compound Name | 2',7'-dimethylspiro[7,17-dioxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),3,5(9),10,13,15(19)-hexaene-2,9'-fluorene]-6,8,16,18-tetrone;methane |
|---|---|
| PubChem CID | 163656399 |
| Molecular Formula | C33H22O6 |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 2',7'-dimethylspiro[7,17-dioxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),3,5(9),10,13,15(19)-hexaene-2,9'-fluorene]-6,8,16,18-tetrone;methane |
| SMILES | C.Cc1ccc2c(c1)C1(c3cc4c(cc3Cc3cc5c(cc31)C(=O)OC5=O)C(=O)OC4=O)c1cc(C)ccc1-2 |
| InChI | InChI=1S/C32H18O6.CH4/c1-14-3-5-18-19-6-4-15(2)8-27(19)32(26(18)7-14)24-12-22-20(28(33)37-30(22)35)10-16(24)9-17-11-21-23(13-25(17)32)31(36)38-29(21)34;/h3-8,10-13H,9H2,1-2H3;1H4 |
| InChIKey | IQOUOZJQVKQQRW-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|