C31H16O4 — CID 121368252
3,3'-dimethylidene-9,9'-spirobi[indeno[1,2-f][2]benzofuran]-1,1'-dione (PubChem CID 121368252) has the molecular formula C31H16O4 and a molecular weight of 452.47 g/mol. Its IUPAC name is 3,3'-dimethylidene-9,9'-spirobi[indeno[1,2-f][2]benzofuran]-1,1'-dione.
| Compound Name | 3,3'-dimethylidene-9,9'-spirobi[indeno[1,2-f][2]benzofuran]-1,1'-dione |
|---|---|
| PubChem CID | 121368252 |
| Molecular Formula | C31H16O4 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 3,3'-dimethylidene-9,9'-spirobi[indeno[1,2-f][2]benzofuran]-1,1'-dione |
| SMILES | C=C1OC(=O)c2cc3c(cc21)-c1ccccc1C31c2ccccc2-c2cc3c(cc21)C(=O)OC3=C |
| InChI | InChI=1S/C31H16O4/c1-15-19-11-21-17-7-3-5-9-25(17)31(27(21)13-23(19)29(32)34-15)26-10-6-4-8-18(26)22-12-20-16(2)35-30(33)24(20)14-28(22)31/h3-14H,1-2H2 |
| InChIKey | GUZTVXKMWHZCIH-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |