C15H6O5 — CID 134285624
6-methylidene-[2]benzofuro[4,5-g][2]benzofuran-1,3,8-trione (PubChem CID 134285624) has the molecular formula C15H6O5 and a molecular weight of 266.21 g/mol. Its IUPAC name is 6-methylidene-[2]benzofuro[4,5-g][2]benzofuran-1,3,8-trione.
| Compound Name | 6-methylidene-[2]benzofuro[4,5-g][2]benzofuran-1,3,8-trione |
|---|---|
| PubChem CID | 134285624 |
| Molecular Formula | C15H6O5 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 6-methylidene-[2]benzofuro[4,5-g][2]benzofuran-1,3,8-trione |
| SMILES | C=C1OC(=O)c2c1ccc1c3c(ccc21)C(=O)OC3=O |
| InChI | InChI=1S/C15H6O5/c1-6-7-2-3-9-8(11(7)14(17)19-6)4-5-10-12(9)15(18)20-13(10)16/h2-5H,1H2 |
| InChIKey | MNSZAMOFGLGDQK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|