C16H8O4 — CID 11402825
5-hydroxynaphtho[2,1-e][2]benzofuran-1,3-dione (PubChem CID 11402825) has the molecular formula C16H8O4 and a molecular weight of 264.24 g/mol. Its IUPAC name is 5-hydroxynaphtho[2,1-e][2]benzofuran-1,3-dione.
| Compound Name | 5-hydroxynaphtho[2,1-e][2]benzofuran-1,3-dione |
|---|---|
| PubChem CID | 11402825 |
| Molecular Formula | C16H8O4 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 5-hydroxynaphtho[2,1-e][2]benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2c1ccc1c2cc(O)c2ccccc21 |
| InChI | InChI=1S/C16H8O4/c17-13-7-12-9(8-3-1-2-4-10(8)13)5-6-11-14(12)16(19)20-15(11)18/h1-7,17H |
| InChIKey | PALVYTFPSXLIKD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|