C14H6O6 — CID 152964608
9-hydroxy-9H-[2]benzofuro[5,6-e][2]benzofuran-1,3,7-trione (PubChem CID 152964608) has the molecular formula C14H6O6 and a molecular weight of 270.20 g/mol. Its IUPAC name is 9-hydroxy-9H-[2]benzofuro[5,6-e][2]benzofuran-1,3,7-trione.
| Compound Name | 9-hydroxy-9H-[2]benzofuro[5,6-e][2]benzofuran-1,3,7-trione |
|---|---|
| PubChem CID | 152964608 |
| Molecular Formula | C14H6O6 |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 9-hydroxy-9H-[2]benzofuro[5,6-e][2]benzofuran-1,3,7-trione |
| SMILES | O=C1OC(O)c2cc3c4c(ccc3cc21)C(=O)OC4=O |
| InChI | InChI=1S/C14H6O6/c15-11-6-2-1-5-3-8-9(13(17)19-12(8)16)4-7(5)10(6)14(18)20-11/h1-4,13,17H |
| InChIKey | URGLNURGNDHYAL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|