C16H10O3 — CID 92860879
(4R)-4-hydroxy-3-oxatetracyclo[7.6.2.05,17.012,16]heptadeca-1(15),5,7,9(17),10,12(16),13-heptaen-2-one (PubChem CID 92860879) has the molecular formula C16H10O3 and a molecular weight of 250.25 g/mol. Its IUPAC name is (4R)-4-hydroxy-3-oxatetracyclo[7.6.2.05,17.012,16]heptadeca-1(15),5,7,9(17),10,12(16),13-heptaen-2-one.
| Compound Name | (4R)-4-hydroxy-3-oxatetracyclo[7.6.2.05,17.012,16]heptadeca-1(15),5,7,9(17),10,12(16),13-heptaen-2-one |
|---|---|
| PubChem CID | 92860879 |
| Molecular Formula | C16H10O3 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | (4R)-4-hydroxy-3-oxatetracyclo[7.6.2.05,17.012,16]heptadeca-1(15),5,7,9(17),10,12(16),13-heptaen-2-one |
| SMILES | O=C1O[C@@H](O)c2cccc3ccc4cccc1c4c23 |
| InChI | InChI=1S/C16H10O3/c17-15-11-5-1-3-9-7-8-10-4-2-6-12(16(18)19-15)14(10)13(9)11/h1-8,15,17H/t15-/m1/s1 |
| InChIKey | FHNQXICDGGUJIP-OAHLLOKOSA-N |
| XLogP | 3.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|