C31H26N2O6 — CID 139201409
N,N-dimethylpyridin-1-ium-4-amine;8-formylnaphthalene-1-carboxylate;(4R)-4-hydroxy-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-2-one (PubChem CID 139201409) has the molecular formula C31H26N2O6 and a molecular weight of 522.56 g/mol. Its IUPAC name is N,N-dimethylpyridin-1-ium-4-amine;8-formylnaphthalene-1-carboxylate;(4R)-4-hydroxy-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-2-one.
| Compound Name | N,N-dimethylpyridin-1-ium-4-amine;8-formylnaphthalene-1-carboxylate;(4R)-4-hydroxy-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-2-one |
|---|---|
| PubChem CID | 139201409 |
| Molecular Formula | C31H26N2O6 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | N,N-dimethylpyridin-1-ium-4-amine;8-formylnaphthalene-1-carboxylate;(4R)-4-hydroxy-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-2-one |
| SMILES | CN(C)c1cc[nH+]cc1.O=C1O[C@@H](O)c2cccc3cccc1c23.O=Cc1cccc2cccc(C(=O)[O-])c12 |
| InChI | InChI=1S/2C12H8O3.C7H10N2/c13-11-8-5-1-3-7-4-2-6-9(10(7)8)12(14)15-11;13-7-9-5-1-3-8-4-2-6-10(11(8)9)12(14)15;1-9(2)7-3-5-8-6-4-7/h1-6,11,13H;1-7H,(H,14,15);3-6H,1-2H3/t11-;;/m1../s1 |
| InChIKey | ZEMLWMDJSOIVIC-NVJADKKVSA-N |
| XLogP | 3.58 |
| TPSA | 121.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|