C14H16N2O3 — CID 139147116
4-carboxyphenolate;N,N-dimethylpyridin-1-ium-4-amine (PubChem CID 139147116) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-carboxyphenolate;N,N-dimethylpyridin-1-ium-4-amine.
| Compound Name | 4-carboxyphenolate;N,N-dimethylpyridin-1-ium-4-amine |
|---|---|
| PubChem CID | 139147116 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 4-carboxyphenolate;N,N-dimethylpyridin-1-ium-4-amine |
| SMILES | CN(C)c1cc[nH+]cc1.O=C(O)c1ccc([O-])cc1 |
| InChI | InChI=1S/C7H10N2.C7H6O3/c1-9(2)7-3-5-8-6-4-7;8-6-3-1-5(2-4-6)7(9)10/h3-6H,1-2H3;1-4,8H,(H,9,10) |
| InChIKey | HMGOMTKIEOFSRV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |