About disodium;4-carboxyphenolate;chloride
disodium;4-carboxyphenolate;chloride (PubChem CID 67831495) has the molecular formula C7H5ClNa2O3
and a molecular weight of 218.55 g/mol. Its IUPAC name is disodium;4-carboxyphenolate;chloride.
Molecular Properties
| Compound Name | disodium;4-carboxyphenolate;chloride |
| PubChem CID | 67831495 |
| Molecular Formula | C7H5ClNa2O3 |
| Molecular Weight | 218.55 g/mol |
| Exact Mass | 217.97 |
| IUPAC Name | disodium;4-carboxyphenolate;chloride |
| SMILES | O=C(O)c1ccc([O-])cc1.[Cl-].[Na+].[Na+] |
| InChI | InChI=1S/C7H6O3.ClH.2Na/c8-6-3-1-5(2-4-6)7(9)10;;;/h1-4,8H,(H,9,10);1H;;/q;;2*+1/p-2 |
| InChIKey | VBPDTQPYYABRDF-UHFFFAOYSA-L |
| XLogP | -8.53 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.55 |
| LogP ≤ 5 | -8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze disodium;4-carboxyphenolate;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;4-carboxyphenolate;chloride?
The IUPAC name of disodium;4-carboxyphenolate;chloride (CID 67831495) is disodium;4-carboxyphenolate;chloride.
What is the SMILES notation for disodium;4-carboxyphenolate;chloride?
The canonical SMILES for disodium;4-carboxyphenolate;chloride is O=C(O)c1ccc([O-])cc1.[Cl-].[Na+].[Na+].
What is the InChIKey of disodium;4-carboxyphenolate;chloride?
The InChIKey is VBPDTQPYYABRDF-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H6O3.ClH.2Na/c8-6-3-1-5(2-4-6)7(9)10;;;/h1-4,8H,(H,9,10);1H;;/q;;2*+1/p-2.
What are the key properties of disodium;4-carboxyphenolate;chloride?
disodium;4-carboxyphenolate;chloride has a molecular weight of 218.55 g/mol, XLogP of -8.53, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;4-carboxyphenolate;chloride is sourced from PubChem (CID 67831495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).