About zinc bis(4-carboxyphenolate)
zinc bis(4-carboxyphenolate) (PubChem CID 54710984) has the molecular formula C14H10O6Zn
and a molecular weight of 339.62 g/mol. Its IUPAC name is zinc bis(4-carboxyphenolate).
Molecular Properties
| Compound Name | zinc bis(4-carboxyphenolate) |
| PubChem CID | 54710984 |
| Molecular Formula | C14H10O6Zn |
| Molecular Weight | 339.62 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | zinc bis(4-carboxyphenolate) |
| SMILES | O=C(O)c1ccc([O-])cc1.O=C(O)c1ccc([O-])cc1.[Zn+2] |
| InChI | InChI=1S/2C7H6O3.Zn/c2*8-6-3-1-5(2-4-6)7(9)10;/h2*1-4,8H,(H,9,10);/q;;+2/p-2 |
| InChIKey | MCJUKSDGOUYTFB-UHFFFAOYSA-L |
| XLogP | 0.91 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.62 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(4-carboxyphenolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(4-carboxyphenolate)?
The IUPAC name of zinc bis(4-carboxyphenolate) (CID 54710984) is zinc bis(4-carboxyphenolate).
What is the SMILES notation for zinc bis(4-carboxyphenolate)?
The canonical SMILES for zinc bis(4-carboxyphenolate) is O=C(O)c1ccc([O-])cc1.O=C(O)c1ccc([O-])cc1.[Zn+2].
What is the InChIKey of zinc bis(4-carboxyphenolate)?
The InChIKey is MCJUKSDGOUYTFB-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H6O3.Zn/c2*8-6-3-1-5(2-4-6)7(9)10;/h2*1-4,8H,(H,9,10);/q;;+2/p-2.
What are the key properties of zinc bis(4-carboxyphenolate)?
zinc bis(4-carboxyphenolate) has a molecular weight of 339.62 g/mol, XLogP of 0.91, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(4-carboxyphenolate) is sourced from PubChem (CID 54710984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).