C8H11N2O+ — CID 76541174
N,N-dimethylpyridin-1-ium-4-carboxamide (PubChem CID 76541174) has the molecular formula C8H11N2O+ and a molecular weight of 151.19 g/mol. Its IUPAC name is N,N-dimethylpyridin-1-ium-4-carboxamide.
| Compound Name | N,N-dimethylpyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 76541174 |
| Molecular Formula | C8H11N2O+ |
| Molecular Weight | 151.19 g/mol |
| Exact Mass | 151.09 |
| IUPAC Name | N,N-dimethylpyridin-1-ium-4-carboxamide |
| SMILES | CN(C)C(=O)c1cc[nH+]cc1 |
| InChI | InChI=1S/C8H10N2O/c1-10(2)8(11)7-3-5-9-6-4-7/h3-6H,1-2H3/p+1 |
| InChIKey | WYQRNAHSMSMAMV-UHFFFAOYSA-O |
| XLogP | 0.20 |
| TPSA | 34.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.19 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |