C12H20N2O2 — CID 143686918
N,N-dimethylmethanamine;4-hydroxy-N,N-dimethylbenzamide (PubChem CID 143686918) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is N,N-dimethylmethanamine;4-hydroxy-N,N-dimethylbenzamide.
| Compound Name | N,N-dimethylmethanamine;4-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 143686918 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | N,N-dimethylmethanamine;4-hydroxy-N,N-dimethylbenzamide |
| SMILES | CN(C)C.CN(C)C(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H11NO2.C3H9N/c1-10(2)9(12)7-3-5-8(11)6-4-7;1-4(2)3/h3-6,11H,1-2H3;1-3H3 |
| InChIKey | HJDLXKNYHKFRAR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |