C9H10AsNO2 — CID 3027013
4-arsoroso-N,N-dimethylbenzamide (PubChem CID 3027013) has the molecular formula C9H10AsNO2 and a molecular weight of 239.11 g/mol. Its IUPAC name is 4-arsoroso-N,N-dimethylbenzamide.
| Compound Name | 4-arsoroso-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 3027013 |
| Molecular Formula | C9H10AsNO2 |
| Molecular Weight | 239.11 g/mol |
| Exact Mass | 238.99 |
| IUPAC Name | 4-arsoroso-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc([As]=O)cc1 |
| InChI | InChI=1S/C9H10AsNO2/c1-11(2)9(12)7-3-5-8(10-13)6-4-7/h3-6H,1-2H3 |
| InChIKey | CFJMXRNDXGVIDX-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.11 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|