C10H11NO3 — CID 82544291
5-(dimethylamino)-3-hydroxy-3H-2-benzofuran-1-one (PubChem CID 82544291) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 5-(dimethylamino)-3-hydroxy-3H-2-benzofuran-1-one.
| Compound Name | 5-(dimethylamino)-3-hydroxy-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 82544291 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 5-(dimethylamino)-3-hydroxy-3H-2-benzofuran-1-one |
| SMILES | CN(C)c1ccc2c(c1)C(O)OC2=O |
| InChI | InChI=1S/C10H11NO3/c1-11(2)6-3-4-7-8(5-6)10(13)14-9(7)12/h3-5,10,13H,1-2H3 |
| InChIKey | PPKYLXPTNIDSPS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |