C16H10O3 — CID 144902513
7,8-bis(ethenyl)benzo[e][2]benzofuran-1,3-dione (PubChem CID 144902513) has the molecular formula C16H10O3 and a molecular weight of 250.25 g/mol. Its IUPAC name is 7,8-bis(ethenyl)benzo[e][2]benzofuran-1,3-dione.
| Compound Name | 7,8-bis(ethenyl)benzo[e][2]benzofuran-1,3-dione |
|---|---|
| PubChem CID | 144902513 |
| Molecular Formula | C16H10O3 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 7,8-bis(ethenyl)benzo[e][2]benzofuran-1,3-dione |
| SMILES | C=Cc1cc2ccc3c(c2cc1C=C)C(=O)OC3=O |
| InChI | InChI=1S/C16H10O3/c1-3-9-7-11-5-6-12-14(16(18)19-15(12)17)13(11)8-10(9)4-2/h3-8H,1-2H2 |
| InChIKey | CZRUSMCCXMILNY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|