C10H6O4 — CID 157330264
7-ethenyl-3,4-dioxabicyclo[4.2.2]deca-1(8),6,9-triene-2,5-dione (PubChem CID 157330264) has the molecular formula C10H6O4 and a molecular weight of 190.15 g/mol. Its IUPAC name is 7-ethenyl-3,4-dioxabicyclo[4.2.2]deca-1(8),6,9-triene-2,5-dione.
| Compound Name | 7-ethenyl-3,4-dioxabicyclo[4.2.2]deca-1(8),6,9-triene-2,5-dione |
|---|---|
| PubChem CID | 157330264 |
| Molecular Formula | C10H6O4 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | 7-ethenyl-3,4-dioxabicyclo[4.2.2]deca-1(8),6,9-triene-2,5-dione |
| SMILES | C=Cc1cc2ccc1C(=O)OOC2=O |
| InChI | InChI=1S/C10H6O4/c1-2-6-5-7-3-4-8(6)10(12)14-13-9(7)11/h2-5H,1H2 |
| InChIKey | BFEZCCMGSOWXSG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|