C16H6O7 — CID 57145576
12-hydroxy-6,15-dioxatetracyclo[9.7.0.04,17.08,13]octadeca-1(18),2,4(17),8(13),9,11-hexaene-5,7,14,16-tetrone (PubChem CID 57145576) has the molecular formula C16H6O7 and a molecular weight of 310.22 g/mol. Its IUPAC name is 12-hydroxy-6,15-dioxatetracyclo[9.7.0.04,17.08,13]octadeca-1(18),2,4(17),8(13),9,11-hexaene-5,7,14,16-tetrone.
| Compound Name | 12-hydroxy-6,15-dioxatetracyclo[9.7.0.04,17.08,13]octadeca-1(18),2,4(17),8(13),9,11-hexaene-5,7,14,16-tetrone |
|---|---|
| PubChem CID | 57145576 |
| Molecular Formula | C16H6O7 |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 12-hydroxy-6,15-dioxatetracyclo[9.7.0.04,17.08,13]octadeca-1(18),2,4(17),8(13),9,11-hexaene-5,7,14,16-tetrone |
| SMILES | O=C1OC(=O)c2ccc3c(O)c2C(=O)OC(=O)c2cc-3ccc21 |
| InChI | InChI=1S/C16H6O7/c17-12-7-3-4-9-11(12)16(21)23-15(20)10-5-6(7)1-2-8(10)13(18)22-14(9)19/h1-5,17H |
| InChIKey | NNZOSQLQXSIBMZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|