C19H10O3 — CID 58971145
14-oxapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(18),2,4,6,9(19),10,12(20),16-octaene-13,15-dione (PubChem CID 58971145) has the molecular formula C19H10O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 14-oxapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(18),2,4,6,9(19),10,12(20),16-octaene-13,15-dione.
| Compound Name | 14-oxapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(18),2,4,6,9(19),10,12(20),16-octaene-13,15-dione |
|---|---|
| PubChem CID | 58971145 |
| Molecular Formula | C19H10O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 14-oxapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(18),2,4,6,9(19),10,12(20),16-octaene-13,15-dione |
| SMILES | O=C1OC(=O)c2ccc3c4c(ccc1c24)Cc1ccccc1-3 |
| InChI | InChI=1S/C19H10O3/c20-18-14-6-5-11-9-10-3-1-2-4-12(10)13-7-8-15(19(21)22-18)17(14)16(11)13/h1-8H,9H2 |
| InChIKey | IVAJFJXDMNERKB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|