C14H8O3 — CID 4669379
6-oxatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione (PubChem CID 4669379) has the molecular formula C14H8O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is 6-oxatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione.
| Compound Name | 6-oxatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione |
|---|---|
| PubChem CID | 4669379 |
| Molecular Formula | C14H8O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 6-oxatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione |
| SMILES | O=C1OC(=O)c2ccc3c4c(ccc1c24)CC3 |
| InChI | InChI=1S/C14H8O3/c15-13-9-5-3-7-1-2-8-4-6-10(14(16)17-13)12(9)11(7)8/h3-6H,1-2H2 |
| InChIKey | JDLNUOOGRNIDEQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|