C16H6O6 — CID 56611654
11-phenyl-4,9-dioxatricyclo[5.3.2.02,6]dodeca-1(11),2(6),7(12)-triene-3,5,8,10-tetrone (PubChem CID 56611654) has the molecular formula C16H6O6 and a molecular weight of 294.22 g/mol. Its IUPAC name is 11-phenyl-4,9-dioxatricyclo[5.3.2.02,6]dodeca-1(11),2(6),7(12)-triene-3,5,8,10-tetrone.
| Compound Name | 11-phenyl-4,9-dioxatricyclo[5.3.2.02,6]dodeca-1(11),2(6),7(12)-triene-3,5,8,10-tetrone |
|---|---|
| PubChem CID | 56611654 |
| Molecular Formula | C16H6O6 |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 11-phenyl-4,9-dioxatricyclo[5.3.2.02,6]dodeca-1(11),2(6),7(12)-triene-3,5,8,10-tetrone |
| SMILES | O=C1OC(=O)c2c1c1cc(-c3ccccc3)c2c(=O)oc1=O |
| InChI | InChI=1S/C16H6O6/c17-13-9-6-8(7-4-2-1-3-5-7)10(14(18)21-13)12-11(9)15(19)22-16(12)20/h1-6H |
| InChIKey | QKUWRLIYRXMIMS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 90.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|