About 3-methyl-7,8-diphenylchromeno[3,4-d][1,2]oxazol-4-one
3-methyl-7,8-diphenylchromeno[3,4-d][1,2]oxazol-4-one (PubChem CID 134912057) has the molecular formula C23H15NO3
and a molecular weight of 353.38 g/mol. Its IUPAC name is 3-methyl-7,8-diphenylchromeno[3,4-d][1,2]oxazol-4-one.
Molecular Properties
| Compound Name | 3-methyl-7,8-diphenylchromeno[3,4-d][1,2]oxazol-4-one |
| PubChem CID | 134912057 |
| Molecular Formula | C23H15NO3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 3-methyl-7,8-diphenylchromeno[3,4-d][1,2]oxazol-4-one |
| SMILES | Cc1noc2c1c(=O)oc1cc(-c3ccccc3)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C23H15NO3/c1-14-21-22(27-24-14)19-12-17(15-8-4-2-5-9-15)18(13-20(19)26-23(21)25)16-10-6-3-7-11-16/h2-13H,1H3 |
| InChIKey | HUQWVUHFYDOXEY-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-7,8-diphenylchromeno[3,4-d][1,2]oxazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-7,8-diphenylchromeno[3,4-d][1,2]oxazol-4-one?
The IUPAC name of 3-methyl-7,8-diphenylchromeno[3,4-d][1,2]oxazol-4-one (CID 134912057) is 3-methyl-7,8-diphenylchromeno[3,4-d][1,2]oxazol-4-one.
What is the SMILES notation for 3-methyl-7,8-diphenylchromeno[3,4-d][1,2]oxazol-4-one?
The canonical SMILES for 3-methyl-7,8-diphenylchromeno[3,4-d][1,2]oxazol-4-one is Cc1noc2c1c(=O)oc1cc(-c3ccccc3)c(-c3ccccc3)cc12.
What is the InChIKey of 3-methyl-7,8-diphenylchromeno[3,4-d][1,2]oxazol-4-one?
The InChIKey is HUQWVUHFYDOXEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15NO3/c1-14-21-22(27-24-14)19-12-17(15-8-4-2-5-9-15)18(13-20(19)26-23(21)25)16-10-6-3-7-11-16/h2-13H,1H3.
What are the key properties of 3-methyl-7,8-diphenylchromeno[3,4-d][1,2]oxazol-4-one?
3-methyl-7,8-diphenylchromeno[3,4-d][1,2]oxazol-4-one has a molecular weight of 353.38 g/mol, XLogP of 5.58, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-7,8-diphenylchromeno[3,4-d][1,2]oxazol-4-one is sourced from PubChem (CID 134912057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).